Calcium Citrate Malate
| Product Name: | Calcium Citrate Malate |
| Product Formula: | Ca6(C6H5O7)2(C4H4O5)3.6H2O |
| Molecular Weight: | 1123.10 |
| CAS Number: |
| No. | Tests | Specifications | Reference |
|---|---|---|---|
| 1 | Description | White powder, Odourless | In-house |
| 2 | Solubility | Slightly soluble in water, freely soluble in 3N Hydrochloric acid | In-house |
| 3 | Identification | Shall pass the test | In-house |
| 4 | Loss on drying (150°C for 2hrs | Max. 10% | In-house |
| 5 | Acid - Insoluble substances | Max. 0.2% | In-house |
| 6 | Lead | Max. 10 ppm | In-house |
| 7 | Heavy Metals | Max. 20 ppm | In-house |
| 8 | Arsenic | Max. 3 ppm | In-house |
| 9 | Assay | 20.0% - 23.0% | In-house |
| 10 | Bulk Density A. Loose B. Tapped |
Min. 0.40 g/ml Min. 0.50 g/ml |
In-house |
Storage: Store in a well-closed container at a temperature not exceeding 25°C, protected from direct sunlight and Moisture, unless otherwise specified.
Retest Period: 3 years from the date of manufacture.
